C13H14N2O2 — CID 70277670
8-amino-6,7,8,9-tetrahydrodibenzofuran-2-carboxamide (PubChem CID 70277670) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 8-amino-6,7,8,9-tetrahydrodibenzofuran-2-carboxamide.
| Compound Name | 8-amino-6,7,8,9-tetrahydrodibenzofuran-2-carboxamide |
|---|---|
| PubChem CID | 70277670 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 8-amino-6,7,8,9-tetrahydrodibenzofuran-2-carboxamide |
| SMILES | NC(=O)c1ccc2oc3c(c2c1)CC(N)CC3 |
| InChI | InChI=1S/C13H14N2O2/c14-8-2-4-12-10(6-8)9-5-7(13(15)16)1-3-11(9)17-12/h1,3,5,8H,2,4,6,14H2,(H2,15,16) |
| InChIKey | REKKALTVHKTYLO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |