About ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate
ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate (PubChem CID 70278098) has the molecular formula C19H24N2O2
and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate |
| PubChem CID | 70278098 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncn([C@@H]2CCCC[C@H]2C)c1-c1ccccc1 |
| InChI | InChI=1S/C19H24N2O2/c1-3-23-19(22)17-18(15-10-5-4-6-11-15)21(13-20-17)16-12-8-7-9-14(16)2/h4-6,10-11,13-14,16H,3,7-9,12H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | QCRIATOQDPZSOJ-GDBMZVCRSA-N |
| XLogP | 4.48 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate?
The IUPAC name of ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate (CID 70278098) is ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate.
What is the SMILES notation for ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate?
The canonical SMILES for ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate is CCOC(=O)c1ncn([C@@H]2CCCC[C@H]2C)c1-c1ccccc1.
What is the InChIKey of ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate?
The InChIKey is QCRIATOQDPZSOJ-GDBMZVCRSA-N. The full InChI is InChI=1S/C19H24N2O2/c1-3-23-19(22)17-18(15-10-5-4-6-11-15)21(13-20-17)16-12-8-7-9-14(16)2/h4-6,10-11,13-14,16H,3,7-9,12H2,1-2H3/t14-,16-/m1/s1.
What are the key properties of ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate?
ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate has a molecular weight of 312.41 g/mol, XLogP of 4.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(1R,2R)-2-methylcyclohexyl]-5-phenylimidazole-4-carboxylate is sourced from PubChem (CID 70278098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).