C14H25N3O — CID 70278167
4-methyl-7-[(3R)-3-methylpiperazin-1-yl]-2,3,5,6,7,8-hexahydro-1,4-benzoxazine (PubChem CID 70278167) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-methyl-7-[(3R)-3-methylpiperazin-1-yl]-2,3,5,6,7,8-hexahydro-1,4-benzoxazine.
| Compound Name | 4-methyl-7-[(3R)-3-methylpiperazin-1-yl]-2,3,5,6,7,8-hexahydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 70278167 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 4-methyl-7-[(3R)-3-methylpiperazin-1-yl]-2,3,5,6,7,8-hexahydro-1,4-benzoxazine |
| SMILES | C[C@@H]1CN(C2CCC3=C(C2)OCCN3C)CCN1 |
| InChI | InChI=1S/C14H25N3O/c1-11-10-17(6-5-15-11)12-3-4-13-14(9-12)18-8-7-16(13)2/h11-12,15H,3-10H2,1-2H3/t11-,12?/m1/s1 |
| InChIKey | CVOLECPQXLTEKY-JHJMLUEUSA-N |
| XLogP | 1.01 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |