C8H10O — CID 70278812
1,6,7,7a-tetrahydro-2-benzofuran (PubChem CID 70278812) has the molecular formula C8H10O and a molecular weight of 122.17 g/mol. Its IUPAC name is 1,6,7,7a-tetrahydro-2-benzofuran.
| Compound Name | 1,6,7,7a-tetrahydro-2-benzofuran |
|---|---|
| PubChem CID | 70278812 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 1,6,7,7a-tetrahydro-2-benzofuran |
| SMILES | C1=CC2=COCC2CC1 |
| InChI | InChI=1S/C8H10O/c1-2-4-8-6-9-5-7(8)3-1/h1,3,5,8H,2,4,6H2 |
| InChIKey | KFISRXJAXAATRJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |