C24H29N3O2 — CID 70280381
trans-(1R,2R)-2-[2-[(1,4-dimethylindol-3-yl)methylamino]anilino]cyclohexane-1-carboxylic acid (PubChem CID 70280381) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is trans-(1R,2R)-2-[2-[(1,4-dimethylindol-3-yl)methylamino]anilino]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-[2-[(1,4-dimethylindol-3-yl)methylamino]anilino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 70280381 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | trans-(1R,2R)-2-[2-[(1,4-dimethylindol-3-yl)methylamino]anilino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cccc2c1c(CNc1ccccc1N[C@@H]1CCCC[C@H]1C(=O)O)cn2C |
| InChI | InChI=1S/C24H29N3O2/c1-16-8-7-13-22-23(16)17(15-27(22)2)14-25-20-11-5-6-12-21(20)26-19-10-4-3-9-18(19)24(28)29/h5-8,11-13,15,18-19,25-26H,3-4,9-10,14H2,1-2H3,(H,28,29)/t18-,19-/m1/s1 |
| InChIKey | QOOXBASGKBDDIG-RTBURBONSA-N |
| XLogP | 5.15 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|