About [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol
[1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol (PubChem CID 70280547) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol.
Molecular Properties
| Compound Name | [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol |
| PubChem CID | 70280547 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol |
| SMILES | Cc1cc(C2CCC(=CO)N2C)on1 |
| InChI | InChI=1S/C10H14N2O2/c1-7-5-10(14-11-7)9-4-3-8(6-13)12(9)2/h5-6,9,13H,3-4H2,1-2H3 |
| InChIKey | DMQXRMCRZUKZSJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol?
The IUPAC name of [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol (CID 70280547) is [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol.
What is the SMILES notation for [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol?
The canonical SMILES for [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol is Cc1cc(C2CCC(=CO)N2C)on1.
What is the InChIKey of [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol?
The InChIKey is DMQXRMCRZUKZSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-7-5-10(14-11-7)9-4-3-8(6-13)12(9)2/h5-6,9,13H,3-4H2,1-2H3.
What are the key properties of [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol?
[1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol has a molecular weight of 194.23 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methyl-5-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-2-ylidene]methanol is sourced from PubChem (CID 70280547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).