About [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate
[(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate (PubChem CID 70280823) has the molecular formula C23H30O3SSi
and a molecular weight of 414.64 g/mol. Its IUPAC name is [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate |
| PubChem CID | 70280823 |
| Molecular Formula | C23H30O3SSi |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)S1 |
| InChI | InChI=1S/C23H30O3SSi/c1-18(24)26-22-16-15-19(27-22)17-25-28(23(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22H,15-17H2,1-4H3/t19-,22+/m1/s1 |
| InChIKey | XTOYTTNREVGAJY-KNQAVFIVSA-N |
| XLogP | 4.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate?
The IUPAC name of [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate (CID 70280823) is [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate.
What is the SMILES notation for [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate?
The canonical SMILES for [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate is CC(=O)O[C@@H]1CC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)S1.
What is the InChIKey of [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate?
The InChIKey is XTOYTTNREVGAJY-KNQAVFIVSA-N. The full InChI is InChI=1S/C23H30O3SSi/c1-18(24)26-22-16-15-19(27-22)17-25-28(23(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22H,15-17H2,1-4H3/t19-,22+/m1/s1.
What are the key properties of [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate?
[(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate has a molecular weight of 414.64 g/mol, XLogP of 4.35, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl] acetate is sourced from PubChem (CID 70280823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).