C31H26F2N2O5 — CID 70280897
dibenzyl 5-[2-(2,6-difluorophenyl)ethylcarbamoylamino]benzene-1,3-dicarboxylate (PubChem CID 70280897) has the molecular formula C31H26F2N2O5 and a molecular weight of 544.55 g/mol. Its IUPAC name is dibenzyl 5-[2-(2,6-difluorophenyl)ethylcarbamoylamino]benzene-1,3-dicarboxylate.
| Compound Name | dibenzyl 5-[2-(2,6-difluorophenyl)ethylcarbamoylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 70280897 |
| Molecular Formula | C31H26F2N2O5 |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | dibenzyl 5-[2-(2,6-difluorophenyl)ethylcarbamoylamino]benzene-1,3-dicarboxylate |
| SMILES | O=C(NCCc1c(F)cccc1F)Nc1cc(C(=O)OCc2ccccc2)cc(C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C31H26F2N2O5/c32-27-12-7-13-28(33)26(27)14-15-34-31(38)35-25-17-23(29(36)39-19-21-8-3-1-4-9-21)16-24(18-25)30(37)40-20-22-10-5-2-6-11-22/h1-13,16-18H,14-15,19-20H2,(H2,34,35,38) |
| InChIKey | AOSMSONUMBUMJS-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |