About 6H-imidazo[4,5-c]pyridin-4-amine
6H-imidazo[4,5-c]pyridin-4-amine (PubChem CID 70281405) has the molecular formula C6H6N4
and a molecular weight of 134.14 g/mol. Its IUPAC name is 6H-imidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 6H-imidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 70281405 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 6H-imidazo[4,5-c]pyridin-4-amine |
| SMILES | NC1=NCC=C2N=CN=C21 |
| InChI | InChI=1S/C6H6N4/c7-6-5-4(1-2-8-6)9-3-10-5/h1,3H,2H2,(H2,7,8) |
| InChIKey | FWLBQMUKERHVAZ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 63.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6H-imidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-imidazo[4,5-c]pyridin-4-amine?
The IUPAC name of 6H-imidazo[4,5-c]pyridin-4-amine (CID 70281405) is 6H-imidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for 6H-imidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for 6H-imidazo[4,5-c]pyridin-4-amine is NC1=NCC=C2N=CN=C21.
What is the InChIKey of 6H-imidazo[4,5-c]pyridin-4-amine?
The InChIKey is FWLBQMUKERHVAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4/c7-6-5-4(1-2-8-6)9-3-10-5/h1,3H,2H2,(H2,7,8).
What are the key properties of 6H-imidazo[4,5-c]pyridin-4-amine?
6H-imidazo[4,5-c]pyridin-4-amine has a molecular weight of 134.14 g/mol, XLogP of -0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-imidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 70281405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).