About 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine
9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine (PubChem CID 70281945) has the molecular formula C17H13N3
and a molecular weight of 259.31 g/mol. Its IUPAC name is 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine.
Molecular Properties
| Compound Name | 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine |
| PubChem CID | 70281945 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine |
| SMILES | c1ccc(CC2c3ccccc3-c3ccnnc32)nc1 |
| InChI | InChI=1S/C17H13N3/c1-2-7-14-13(6-1)15-8-10-19-20-17(15)16(14)11-12-5-3-4-9-18-12/h1-10,16H,11H2 |
| InChIKey | BMIDRKLRLYJDKS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine?
The IUPAC name of 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine (CID 70281945) is 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine.
What is the SMILES notation for 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine?
The canonical SMILES for 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine is c1ccc(CC2c3ccccc3-c3ccnnc32)nc1.
What is the InChIKey of 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine?
The InChIKey is BMIDRKLRLYJDKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3/c1-2-7-14-13(6-1)15-8-10-19-20-17(15)16(14)11-12-5-3-4-9-18-12/h1-10,16H,11H2.
What are the key properties of 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine?
9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine has a molecular weight of 259.31 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(pyridin-2-ylmethyl)-9H-indeno[2,1-c]pyridazine is sourced from PubChem (CID 70281945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).