About methylsulfinylmethane;phenol
methylsulfinylmethane;phenol (PubChem CID 70282164) has the molecular formula C14H18O3S
and a molecular weight of 266.36 g/mol. Its IUPAC name is methylsulfinylmethane;phenol.
Molecular Properties
| Compound Name | methylsulfinylmethane;phenol |
| PubChem CID | 70282164 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | methylsulfinylmethane;phenol |
| SMILES | CS(C)=O.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/2C6H6O.C2H6OS/c2*7-6-4-2-1-3-5-6;1-4(2)3/h2*1-5,7H;1-2H3 |
| InChIKey | PHZUURXPXTVYIX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methylsulfinylmethane;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfinylmethane;phenol?
The IUPAC name of methylsulfinylmethane;phenol (CID 70282164) is methylsulfinylmethane;phenol.
What is the SMILES notation for methylsulfinylmethane;phenol?
The canonical SMILES for methylsulfinylmethane;phenol is CS(C)=O.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of methylsulfinylmethane;phenol?
The InChIKey is PHZUURXPXTVYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6O.C2H6OS/c2*7-6-4-2-1-3-5-6;1-4(2)3/h2*1-5,7H;1-2H3.
What are the key properties of methylsulfinylmethane;phenol?
methylsulfinylmethane;phenol has a molecular weight of 266.36 g/mol, XLogP of 2.78, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfinylmethane;phenol is sourced from PubChem (CID 70282164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).