About methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate
methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate (PubChem CID 70282289) has the molecular formula C20H21ClN2O3S
and a molecular weight of 404.92 g/mol. Its IUPAC name is methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate |
| PubChem CID | 70282289 |
| Molecular Formula | C20H21ClN2O3S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(Cl)cc1)NC(=O)c1cccc2c1SCCC2N |
| InChI | InChI=1S/C20H21ClN2O3S/c1-26-20(25)17(11-12-5-7-13(21)8-6-12)23-19(24)15-4-2-3-14-16(22)9-10-27-18(14)15/h2-8,16-17H,9-11,22H2,1H3,(H,23,24)/t16?,17-/m0/s1 |
| InChIKey | XOFGCPYLIPRDDC-DJNXLDHESA-N |
| XLogP | 3.35 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate?
The IUPAC name of methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate (CID 70282289) is methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate.
What is the SMILES notation for methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate?
The canonical SMILES for methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate is COC(=O)[C@H](Cc1ccc(Cl)cc1)NC(=O)c1cccc2c1SCCC2N.
What is the InChIKey of methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate?
The InChIKey is XOFGCPYLIPRDDC-DJNXLDHESA-N. The full InChI is InChI=1S/C20H21ClN2O3S/c1-26-20(25)17(11-12-5-7-13(21)8-6-12)23-19(24)15-4-2-3-14-16(22)9-10-27-18(14)15/h2-8,16-17H,9-11,22H2,1H3,(H,23,24)/t16?,17-/m0/s1.
What are the key properties of methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate?
methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate has a molecular weight of 404.92 g/mol, XLogP of 3.35, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(4-amino-3,4-dihydro-2H-thiochromene-8-carbonyl)amino]-3-(4-chlorophenyl)propanoate is sourced from PubChem (CID 70282289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).