About 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine
6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine (PubChem CID 70282934) has the molecular formula C14H8BrClF2N2O
and a molecular weight of 373.58 g/mol. Its IUPAC name is 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine.
Molecular Properties
| Compound Name | 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine |
| PubChem CID | 70282934 |
| Molecular Formula | C14H8BrClF2N2O |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine |
| SMILES | FC(F)C1N=C(c2ccccn2)c2cc(Br)c(Cl)cc2O1 |
| InChI | InChI=1S/C14H8BrClF2N2O/c15-8-5-7-11(6-9(8)16)21-14(13(17)18)20-12(7)10-3-1-2-4-19-10/h1-6,13-14H |
| InChIKey | ZCGQVVRXHXJMLB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine?
The IUPAC name of 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine (CID 70282934) is 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine.
What is the SMILES notation for 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine?
The canonical SMILES for 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine is FC(F)C1N=C(c2ccccn2)c2cc(Br)c(Cl)cc2O1.
What is the InChIKey of 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine?
The InChIKey is ZCGQVVRXHXJMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrClF2N2O/c15-8-5-7-11(6-9(8)16)21-14(13(17)18)20-12(7)10-3-1-2-4-19-10/h1-6,13-14H.
What are the key properties of 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine?
6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine has a molecular weight of 373.58 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7-chloro-2-(difluoromethyl)-4-pyridin-2-yl-2H-1,3-benzoxazine is sourced from PubChem (CID 70282934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).