C17H18N4O2 — CID 70283126
4-methyl-2-(6-methyl-3-pyridinyl)-1H-triazolo[1,5-a]quinolin-1-ium-3-ol hydroxide (PubChem CID 70283126) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-methyl-2-(6-methyl-3-pyridinyl)-1H-triazolo[1,5-a]quinolin-1-ium-3-ol hydroxide.
| Compound Name | 4-methyl-2-(6-methyl-3-pyridinyl)-1H-triazolo[1,5-a]quinolin-1-ium-3-ol hydroxide |
|---|---|
| PubChem CID | 70283126 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-methyl-2-(6-methyl-3-pyridinyl)-1H-triazolo[1,5-a]quinolin-1-ium-3-ol hydroxide |
| SMILES | CC1=Cc2ccccc2N2[NH2+]N(c3ccc(C)nc3)C(O)=C12.[OH-] |
| InChI | InChI=1S/C17H16N4O.H2O/c1-11-9-13-5-3-4-6-15(13)21-16(11)17(22)20(19-21)14-8-7-12(2)18-10-14;/h3-10,19,22H,1-2H3;1H2 |
| InChIKey | GLAPGCKDUJYDMK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|