C22H23FN4O5 — CID 70283220
[6-(1-amino-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-7-fluoro-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-11-yl] hydrogen carbonate (PubChem CID 70283220) has the molecular formula C22H23FN4O5 and a molecular weight of 442.45 g/mol. Its IUPAC name is [6-(1-amino-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-7-fluoro-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-11-yl] hydrogen carbonate.
| Compound Name | [6-(1-amino-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-7-fluoro-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-11-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70283220 |
| Molecular Formula | C22H23FN4O5 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [6-(1-amino-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-7-fluoro-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-11-yl] hydrogen carbonate |
| SMILES | CN1COc2c(N3CC4C5C=CC(N)(CC5)C4C3)c(F)cc3c(=O)c(OC(=O)O)cn1c23 |
| InChI | InChI=1S/C22H23FN4O5/c1-25-10-31-20-17-12(19(28)16(9-27(17)25)32-21(29)30)6-15(23)18(20)26-7-13-11-2-4-22(24,5-3-11)14(13)8-26/h2,4,6,9,11,13-14H,3,5,7-8,10,24H2,1H3,(H,29,30) |
| InChIKey | WWQVLDPNCFIGRT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|