C44H45N3O8 — CID 70284301
bis(prop-2-enyl) 5-[[3-[[6-(1-adamantylmethylcarbamoyl)-1-benzofuran-5-carbonyl]amino]-2-phenylpropanoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 70284301) has the molecular formula C44H45N3O8 and a molecular weight of 743.86 g/mol. Its IUPAC name is bis(prop-2-enyl) 5-[[3-[[6-(1-adamantylmethylcarbamoyl)-1-benzofuran-5-carbonyl]amino]-2-phenylpropanoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 5-[[3-[[6-(1-adamantylmethylcarbamoyl)-1-benzofuran-5-carbonyl]amino]-2-phenylpropanoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 70284301 |
| Molecular Formula | C44H45N3O8 |
| Molecular Weight | 743.86 g/mol |
| Exact Mass | 743.32 |
| IUPAC Name | bis(prop-2-enyl) 5-[[3-[[6-(1-adamantylmethylcarbamoyl)-1-benzofuran-5-carbonyl]amino]-2-phenylpropanoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | C=CCOC(=O)c1cc(NC(=O)C(CNC(=O)c2cc3ccoc3cc2C(=O)NCC23CC4CC(CC(C4)C2)C3)c2ccccc2)cc(C(=O)OCC=C)c1 |
| InChI | InChI=1S/C44H45N3O8/c1-3-11-54-42(51)32-17-33(43(52)55-12-4-2)19-34(18-32)47-41(50)37(30-8-6-5-7-9-30)25-45-39(48)35-20-31-10-13-53-38(31)21-36(35)40(49)46-26-44-22-27-14-28(23-44)16-29(15-27)24-44/h3-10,13,17-21,27-29,37H,1-2,11-12,14-16,22-26H2,(H,45,48)(H,46,49)(H,47,50) |
| InChIKey | ICGDVRVJCLXQES-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 153.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.86 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|