C24H30N2O5 — CID 70284381
(1S,13R,14S,17S)-20-hydroxy-13,14,18,18-tetramethyl-7,19-dioxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-9-carboxamide (PubChem CID 70284381) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is (1S,13R,14S,17S)-20-hydroxy-13,14,18,18-tetramethyl-7,19-dioxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-9-carboxamide.
| Compound Name | (1S,13R,14S,17S)-20-hydroxy-13,14,18,18-tetramethyl-7,19-dioxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-9-carboxamide |
|---|---|
| PubChem CID | 70284381 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (1S,13R,14S,17S)-20-hydroxy-13,14,18,18-tetramethyl-7,19-dioxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-9-carboxamide |
| SMILES | C[C@H]1CC[C@H]2C(C)(C)C(=O)C(O)C[C@]23Oc2c(cc(C(N)=O)c4c2CNC4=O)C[C@]13C |
| InChI | InChI=1S/C24H30N2O5/c1-11-5-6-16-22(2,3)19(28)15(27)9-24(16)23(11,4)8-12-7-13(20(25)29)17-14(18(12)31-24)10-26-21(17)30/h7,11,15-16,27H,5-6,8-10H2,1-4H3,(H2,25,29)(H,26,30)/t11-,15?,16-,23+,24-/m0/s1 |
| InChIKey | OLNDRNMJFCAFMM-MVOCPXTNSA-N |
| XLogP | 2.11 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |