C28H26F3N3O10S — CID 70284683
2-[4-[2-acetamido-3-oxo-3-[[(6R)-5-oxo-4-[[4-(trifluoromethoxy)phenyl]methyl]-1,4-thiazepan-6-yl]amino]prop-1-enyl]phenoxy]carbonylpropanedioic acid (PubChem CID 70284683) has the molecular formula C28H26F3N3O10S and a molecular weight of 653.59 g/mol. Its IUPAC name is 2-[4-[2-acetamido-3-oxo-3-[[(6R)-5-oxo-4-[[4-(trifluoromethoxy)phenyl]methyl]-1,4-thiazepan-6-yl]amino]prop-1-enyl]phenoxy]carbonylpropanedioic acid.
| Compound Name | 2-[4-[2-acetamido-3-oxo-3-[[(6R)-5-oxo-4-[[4-(trifluoromethoxy)phenyl]methyl]-1,4-thiazepan-6-yl]amino]prop-1-enyl]phenoxy]carbonylpropanedioic acid |
|---|---|
| PubChem CID | 70284683 |
| Molecular Formula | C28H26F3N3O10S |
| Molecular Weight | 653.59 g/mol |
| Exact Mass | 653.13 |
| IUPAC Name | 2-[4-[2-acetamido-3-oxo-3-[[(6R)-5-oxo-4-[[4-(trifluoromethoxy)phenyl]methyl]-1,4-thiazepan-6-yl]amino]prop-1-enyl]phenoxy]carbonylpropanedioic acid |
| SMILES | CC(=O)NC(=Cc1ccc(OC(=O)C(C(=O)O)C(=O)O)cc1)C(=O)N[C@H]1CSCCN(Cc2ccc(OC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C28H26F3N3O10S/c1-15(35)32-20(12-16-2-6-18(7-3-16)43-27(42)22(25(38)39)26(40)41)23(36)33-21-14-45-11-10-34(24(21)37)13-17-4-8-19(9-5-17)44-28(29,30)31/h2-9,12,21-22H,10-11,13-14H2,1H3,(H,32,35)(H,33,36)(H,38,39)(H,40,41)/t21-/m0/s1 |
| InChIKey | SKFZGOJYVSTEBE-NRFANRHFSA-N |
| XLogP | 2.01 |
| TPSA | 188.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.59 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|