C19H23ClN6O2 — CID 70285125
N-[(1R)-1-(6-chloro-1H-benzimidazol-2-yl)-2-methoxyethyl]-7-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide (PubChem CID 70285125) has the molecular formula C19H23ClN6O2 and a molecular weight of 402.89 g/mol. Its IUPAC name is N-[(1R)-1-(6-chloro-1H-benzimidazol-2-yl)-2-methoxyethyl]-7-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide.
| Compound Name | N-[(1R)-1-(6-chloro-1H-benzimidazol-2-yl)-2-methoxyethyl]-7-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 70285125 |
| Molecular Formula | C19H23ClN6O2 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-[(1R)-1-(6-chloro-1H-benzimidazol-2-yl)-2-methoxyethyl]-7-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide |
| SMILES | COC[C@H](NC(=O)c1cn2c(n1)CCN(C)CC2)c1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C19H23ClN6O2/c1-25-6-5-17-21-15(10-26(17)8-7-25)19(27)24-16(11-28-2)18-22-13-4-3-12(20)9-14(13)23-18/h3-4,9-10,16H,5-8,11H2,1-2H3,(H,22,23)(H,24,27)/t16-/m0/s1 |
| InChIKey | SVKBDSFFFUKMTP-INIZCTEOSA-N |
| XLogP | 2.02 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |