C8H9Br2N3OS — CID 7028535
(1R)-2,2-dibromo-1-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide (PubChem CID 7028535) has the molecular formula C8H9Br2N3OS and a molecular weight of 355.06 g/mol. Its IUPAC name is (1R)-2,2-dibromo-1-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dibromo-1-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7028535 |
| Molecular Formula | C8H9Br2N3OS |
| Molecular Weight | 355.06 g/mol |
| Exact Mass | 352.88 |
| IUPAC Name | (1R)-2,2-dibromo-1-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide |
| SMILES | Cc1nnc(NC(=O)[C@@]2(C)CC2(Br)Br)s1 |
| InChI | InChI=1S/C8H9Br2N3OS/c1-4-12-13-6(15-4)11-5(14)7(2)3-8(7,9)10/h3H2,1-2H3,(H,11,13,14)/t7-/m1/s1 |
| InChIKey | URNXREVWOAMTDN-SSDOTTSWSA-N |
| XLogP | 2.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.06 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|