C16H22IN — CID 70285797
1,1,4,7-tetramethyl-3-methylidene-2-prop-2-enylisoindole;hydroiodide (PubChem CID 70285797) has the molecular formula C16H22IN and a molecular weight of 355.26 g/mol. Its IUPAC name is 1,1,4,7-tetramethyl-3-methylidene-2-prop-2-enylisoindole;hydroiodide.
| Compound Name | 1,1,4,7-tetramethyl-3-methylidene-2-prop-2-enylisoindole;hydroiodide |
|---|---|
| PubChem CID | 70285797 |
| Molecular Formula | C16H22IN |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 1,1,4,7-tetramethyl-3-methylidene-2-prop-2-enylisoindole;hydroiodide |
| SMILES | C=CCN1C(=C)c2c(C)ccc(C)c2C1(C)C.I |
| InChI | InChI=1S/C16H21N.HI/c1-7-10-17-13(4)14-11(2)8-9-12(3)15(14)16(17,5)6;/h7-9H,1,4,10H2,2-3,5-6H3;1H |
| InChIKey | PQSBHCNCOJWFIH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|