About 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one
3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one (PubChem CID 70285916) has the molecular formula C17H13F3N4O2
and a molecular weight of 362.31 g/mol. Its IUPAC name is 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one.
Molecular Properties
| Compound Name | 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one |
| PubChem CID | 70285916 |
| Molecular Formula | C17H13F3N4O2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one |
| SMILES | CN1C(=O)c2ccccc2N2NN(c3ccc(C(F)(F)F)cc3)C(O)=C12 |
| InChI | InChI=1S/C17H13F3N4O2/c1-22-14-16(26)23(11-8-6-10(7-9-11)17(18,19)20)21-24(14)13-5-3-2-4-12(13)15(22)25/h2-9,21,26H,1H3 |
| InChIKey | GOLDINKGRCSGQE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one?
The IUPAC name of 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one (CID 70285916) is 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one.
What is the SMILES notation for 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one?
The canonical SMILES for 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one is CN1C(=O)c2ccccc2N2NN(c3ccc(C(F)(F)F)cc3)C(O)=C12.
What is the InChIKey of 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one?
The InChIKey is GOLDINKGRCSGQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3N4O2/c1-22-14-16(26)23(11-8-6-10(7-9-11)17(18,19)20)21-24(14)13-5-3-2-4-12(13)15(22)25/h2-9,21,26H,1H3.
What are the key properties of 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one?
3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one has a molecular weight of 362.31 g/mol, XLogP of 3.22, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-triazolo[1,5-a]quinazolin-5-one is sourced from PubChem (CID 70285916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).