C30H28Br2N4 — CID 70286440
(3aR,10cR)-8-bromo-2-methyl-3,3a,4,5,6,10c-hexahydro-1H-pyrrolo[3,4-c]carbazole;9-bromo-2-methyl-6H-pyrrolo[3,4-c]carbazole (PubChem CID 70286440) has the molecular formula C30H28Br2N4 and a molecular weight of 604.39 g/mol. Its IUPAC name is (3aR,10cR)-8-bromo-2-methyl-3,3a,4,5,6,10c-hexahydro-1H-pyrrolo[3,4-c]carbazole;9-bromo-2-methyl-6H-pyrrolo[3,4-c]carbazole.
| Compound Name | (3aR,10cR)-8-bromo-2-methyl-3,3a,4,5,6,10c-hexahydro-1H-pyrrolo[3,4-c]carbazole;9-bromo-2-methyl-6H-pyrrolo[3,4-c]carbazole |
|---|---|
| PubChem CID | 70286440 |
| Molecular Formula | C30H28Br2N4 |
| Molecular Weight | 604.39 g/mol |
| Exact Mass | 602.07 |
| IUPAC Name | (3aR,10cR)-8-bromo-2-methyl-3,3a,4,5,6,10c-hexahydro-1H-pyrrolo[3,4-c]carbazole;9-bromo-2-methyl-6H-pyrrolo[3,4-c]carbazole |
| SMILES | CN1C[C@@H]2CCc3[nH]c4cc(Br)ccc4c3[C@@H]2C1.Cn1cc2ccc3[nH]c4ccc(Br)cc4c3c2c1 |
| InChI | InChI=1S/C15H17BrN2.C15H11BrN2/c1-18-7-9-2-5-13-15(12(9)8-18)11-4-3-10(16)6-14(11)17-13;1-18-7-9-2-4-14-15(12(9)8-18)11-6-10(16)3-5-13(11)17-14/h3-4,6,9,12,17H,2,5,7-8H2,1H3;2-8,17H,1H3/t9-,12+;/m0./s1 |
| InChIKey | ZOZXHYRKICRZHG-PKKHVXKMSA-N |
| XLogP | 8.10 |
| TPSA | 39.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.39 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|