C17H27BF3NO4 — CID 70286675
2,2,2-trifluoroacetic acid;1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pent-4-en-1-amine (PubChem CID 70286675) has the molecular formula C17H27BF3NO4 and a molecular weight of 377.21 g/mol. Its IUPAC name is 2,2,2-trifluoroacetic acid;1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pent-4-en-1-amine.
| Compound Name | 2,2,2-trifluoroacetic acid;1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pent-4-en-1-amine |
|---|---|
| PubChem CID | 70286675 |
| Molecular Formula | C17H27BF3NO4 |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2,2,2-trifluoroacetic acid;1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pent-4-en-1-amine |
| SMILES | C=CCCC(N)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H26BNO2.C2HF3O2/c1-5-6-7-13(17)16-18-12-9-10-8-11(14(10,2)3)15(12,4)19-16;3-2(4,5)1(6)7/h5,10-13H,1,6-9,17H2,2-4H3;(H,6,7)/t10-,11-,12+,13?,15-;/m0./s1 |
| InChIKey | SCNMNGMYVNYYLK-JCDANENISA-N |
| XLogP | 3.18 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|