C29H32BrNO5 — CID 70286918
(1S,5R,13R,14S,20R)-9-bromo-20-hydroxy-5-(2-hydroxyphenyl)-13,14,18,18-tetramethyl-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-7,19-dione (PubChem CID 70286918) has the molecular formula C29H32BrNO5 and a molecular weight of 554.48 g/mol. Its IUPAC name is (1S,5R,13R,14S,20R)-9-bromo-20-hydroxy-5-(2-hydroxyphenyl)-13,14,18,18-tetramethyl-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-7,19-dione.
| Compound Name | (1S,5R,13R,14S,20R)-9-bromo-20-hydroxy-5-(2-hydroxyphenyl)-13,14,18,18-tetramethyl-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-7,19-dione |
|---|---|
| PubChem CID | 70286918 |
| Molecular Formula | C29H32BrNO5 |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | (1S,5R,13R,14S,20R)-9-bromo-20-hydroxy-5-(2-hydroxyphenyl)-13,14,18,18-tetramethyl-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-7,19-dione |
| SMILES | C[C@H]1CCC2C(C)(C)C(=O)[C@H](O)C[C@]23Oc2c(cc(Br)c4c2[C@@H](c2ccccc2O)NC4=O)C[C@]13C |
| InChI | InChI=1S/C29H32BrNO5/c1-14-9-10-20-27(2,3)25(34)19(33)13-29(20)28(14,4)12-15-11-17(30)21-22(24(15)36-29)23(31-26(21)35)16-7-5-6-8-18(16)32/h5-8,11,14,19-20,23,32-33H,9-10,12-13H2,1-4H3,(H,31,35)/t14-,19+,20?,23+,28+,29-/m0/s1 |
| InChIKey | ZBIHGTITICRCNY-GOONEHQFSA-N |
| XLogP | 5.07 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|