C23H30BrN3O4 — CID 70287998
(1S,13R,14S,17S,19R,20R)-20-amino-19-bromo-13,14,18,18-tetramethyl-9-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one (PubChem CID 70287998) has the molecular formula C23H30BrN3O4 and a molecular weight of 492.41 g/mol. Its IUPAC name is (1S,13R,14S,17S,19R,20R)-20-amino-19-bromo-13,14,18,18-tetramethyl-9-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one.
| Compound Name | (1S,13R,14S,17S,19R,20R)-20-amino-19-bromo-13,14,18,18-tetramethyl-9-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one |
|---|---|
| PubChem CID | 70287998 |
| Molecular Formula | C23H30BrN3O4 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | (1S,13R,14S,17S,19R,20R)-20-amino-19-bromo-13,14,18,18-tetramethyl-9-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one |
| SMILES | C[C@H]1CC[C@H]2C(C)(C)[C@@H](Br)[C@H](N)C[C@]23Oc2c(cc([N+](=O)[O-])c4c2CNC4=O)C[C@]13C |
| InChI | InChI=1S/C23H30BrN3O4/c1-11-5-6-16-21(2,3)19(24)14(25)9-23(16)22(11,4)8-12-7-15(27(29)30)17-13(18(12)31-23)10-26-20(17)28/h7,11,14,16,19H,5-6,8-10,25H2,1-4H3,(H,26,28)/t11-,14+,16-,19-,22+,23-/m0/s1 |
| InChIKey | JJSSEBOSCVEOKI-QHYLEJCUSA-N |
| XLogP | 4.09 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|