C24H30N2O7 — CID 70288007
(1S,5R,13R,14S,17S,20R)-20-hydroxy-5-methoxy-13,14,18,18-tetramethyl-10-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-7,19-dione (PubChem CID 70288007) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is (1S,5R,13R,14S,17S,20R)-20-hydroxy-5-methoxy-13,14,18,18-tetramethyl-10-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-7,19-dione.
| Compound Name | (1S,5R,13R,14S,17S,20R)-20-hydroxy-5-methoxy-13,14,18,18-tetramethyl-10-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-7,19-dione |
|---|---|
| PubChem CID | 70288007 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (1S,5R,13R,14S,17S,20R)-20-hydroxy-5-methoxy-13,14,18,18-tetramethyl-10-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-7,19-dione |
| SMILES | CO[C@H]1NC(=O)c2cc([N+](=O)[O-])c3c(c21)O[C@@]12C[C@@H](O)C(=O)C(C)(C)[C@@H]1CC[C@H](C)[C@@]2(C)C3 |
| InChI | InChI=1S/C24H30N2O7/c1-11-6-7-16-22(2,3)19(28)15(27)10-24(16)23(11,4)9-13-14(26(30)31)8-12-17(18(13)33-24)21(32-5)25-20(12)29/h8,11,15-16,21,27H,6-7,9-10H2,1-5H3,(H,25,29)/t11-,15+,16-,21+,23+,24-/m0/s1 |
| InChIKey | UCDDQEBJUXZEJO-MVRDCOBOSA-N |
| XLogP | 3.07 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|