C10H18ClN3O6 — CID 70288068
1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione;2-chloro-N-(hydroxymethyl)acetamide (PubChem CID 70288068) has the molecular formula C10H18ClN3O6 and a molecular weight of 311.72 g/mol. Its IUPAC name is 1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione;2-chloro-N-(hydroxymethyl)acetamide.
| Compound Name | 1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione;2-chloro-N-(hydroxymethyl)acetamide |
|---|---|
| PubChem CID | 70288068 |
| Molecular Formula | C10H18ClN3O6 |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione;2-chloro-N-(hydroxymethyl)acetamide |
| SMILES | CC1(C)C(=O)N(CO)C(=O)N1CO.O=C(CCl)NCO |
| InChI | InChI=1S/C7H12N2O4.C3H6ClNO2/c1-7(2)5(12)8(3-10)6(13)9(7)4-11;4-1-3(7)5-2-6/h10-11H,3-4H2,1-2H3;6H,1-2H2,(H,5,7) |
| InChIKey | KOEVDFUIOFCIPM-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|