C28H28N4O4 — CID 70288089
(4-methylphenyl) 4-[[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]acetyl]amino]benzoate (PubChem CID 70288089) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is (4-methylphenyl) 4-[[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]acetyl]amino]benzoate.
| Compound Name | (4-methylphenyl) 4-[[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 70288089 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (4-methylphenyl) 4-[[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]acetyl]amino]benzoate |
| SMILES | Cc1ccc(OC(=O)c2ccc(NC(=O)CN3CCC(n4c(=O)[nH]c5ccccc54)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H28N4O4/c1-19-6-12-23(13-7-19)36-27(34)20-8-10-21(11-9-20)29-26(33)18-31-16-14-22(15-17-31)32-25-5-3-2-4-24(25)30-28(32)35/h2-13,22H,14-18H2,1H3,(H,29,33)(H,30,35) |
| InChIKey | PVPGUSBZVABHAR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|