C24H31ClN2O5 — CID 70288523
(1S,13R,14S,17S)-19-chloro-20-methoxy-13,14,18,18-tetramethyl-10-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one (PubChem CID 70288523) has the molecular formula C24H31ClN2O5 and a molecular weight of 462.97 g/mol. Its IUPAC name is (1S,13R,14S,17S)-19-chloro-20-methoxy-13,14,18,18-tetramethyl-10-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one.
| Compound Name | (1S,13R,14S,17S)-19-chloro-20-methoxy-13,14,18,18-tetramethyl-10-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one |
|---|---|
| PubChem CID | 70288523 |
| Molecular Formula | C24H31ClN2O5 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (1S,13R,14S,17S)-19-chloro-20-methoxy-13,14,18,18-tetramethyl-10-nitro-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one |
| SMILES | COC1C[C@@]23Oc4c5c(cc([N+](=O)[O-])c4C[C@]2(C)[C@@H](C)CC[C@H]3C(C)(C)C1Cl)C(=O)NC5 |
| InChI | InChI=1S/C24H31ClN2O5/c1-12-6-7-18-22(2,3)20(25)17(31-5)10-24(18)23(12,4)9-14-16(27(29)30)8-13-15(19(14)32-24)11-26-21(13)28/h8,12,17-18,20H,6-7,9-11H2,1-5H3,(H,26,28)/t12-,17?,18-,20?,23+,24-/m0/s1 |
| InChIKey | FEEHTHMUPKWDEI-SGHCETCCSA-N |
| XLogP | 4.62 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|