C24H29ClN2O3 — CID 70288599
(1S,13R,14S,17S)-20-chloro-19-hydroxy-13,14,18,18-tetramethyl-7-oxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-9-carbonitrile (PubChem CID 70288599) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is (1S,13R,14S,17S)-20-chloro-19-hydroxy-13,14,18,18-tetramethyl-7-oxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-9-carbonitrile.
| Compound Name | (1S,13R,14S,17S)-20-chloro-19-hydroxy-13,14,18,18-tetramethyl-7-oxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-9-carbonitrile |
|---|---|
| PubChem CID | 70288599 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (1S,13R,14S,17S)-20-chloro-19-hydroxy-13,14,18,18-tetramethyl-7-oxo-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-triene-9-carbonitrile |
| SMILES | C[C@H]1CC[C@H]2C(C)(C)C(O)C(Cl)C[C@]23Oc2c(cc(C#N)c4c2CNC4=O)C[C@]13C |
| InChI | InChI=1S/C24H29ClN2O3/c1-12-5-6-17-22(2,3)20(28)16(25)9-24(17)23(12,4)8-13-7-14(10-26)18-15(19(13)30-24)11-27-21(18)29/h7,12,16-17,20,28H,5-6,8-9,11H2,1-4H3,(H,27,29)/t12-,16?,17-,20?,23+,24-/m0/s1 |
| InChIKey | CYYMQVYSKUCDMO-JMRYTDDTSA-N |
| XLogP | 3.93 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|