C25H26N2O4 — CID 70288741
(3aS,10cS)-2-methyl-4-phenyl-3,3a,4,5,6,10c-hexahydro-1H-pyrrolo[3,4-c]carbazole;(E)-but-2-enedioic acid (PubChem CID 70288741) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is (3aS,10cS)-2-methyl-4-phenyl-3,3a,4,5,6,10c-hexahydro-1H-pyrrolo[3,4-c]carbazole;(E)-but-2-enedioic acid.
| Compound Name | (3aS,10cS)-2-methyl-4-phenyl-3,3a,4,5,6,10c-hexahydro-1H-pyrrolo[3,4-c]carbazole;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70288741 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (3aS,10cS)-2-methyl-4-phenyl-3,3a,4,5,6,10c-hexahydro-1H-pyrrolo[3,4-c]carbazole;(E)-but-2-enedioic acid |
| SMILES | CN1C[C@@H]2c3c([nH]c4ccccc34)CC(c3ccccc3)[C@@H]2C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H22N2.C4H4O4/c1-23-12-17-16(14-7-3-2-4-8-14)11-20-21(18(17)13-23)15-9-5-6-10-19(15)22-20;5-3(6)1-2-4(7)8/h2-10,16-18,22H,11-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t16?,17-,18-;/m0./s1 |
| InChIKey | KXEDJKYYHFFLCR-XEWUUMHOSA-N |
| XLogP | 3.86 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|