C22H27NO3 — CID 70289258
4-[(5,5,8,8-tetramethyl-3,4,6,7-tetrahydronaphthalene-2-carbonyl)amino]benzoic acid (PubChem CID 70289258) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 4-[(5,5,8,8-tetramethyl-3,4,6,7-tetrahydronaphthalene-2-carbonyl)amino]benzoic acid.
| Compound Name | 4-[(5,5,8,8-tetramethyl-3,4,6,7-tetrahydronaphthalene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 70289258 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-[(5,5,8,8-tetramethyl-3,4,6,7-tetrahydronaphthalene-2-carbonyl)amino]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)C2=C1C=C(C(=O)Nc1ccc(C(=O)O)cc1)CC2 |
| InChI | InChI=1S/C22H27NO3/c1-21(2)11-12-22(3,4)18-13-15(7-10-17(18)21)19(24)23-16-8-5-14(6-9-16)20(25)26/h5-6,8-9,13H,7,10-12H2,1-4H3,(H,23,24)(H,25,26) |
| InChIKey | FRHXIAJATVLJDM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |