About N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide
N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide (PubChem CID 70289449) has the molecular formula C13H21N5O2
and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide |
| PubChem CID | 70289449 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCN1CCN(C(=O)C2=CNCC=N2)CC1 |
| InChI | InChI=1S/C13H21N5O2/c1-11(19)15-4-5-17-6-8-18(9-7-17)13(20)12-10-14-2-3-16-12/h3,10,14H,2,4-9H2,1H3,(H,15,19) |
| InChIKey | GDPLOAVCPVEMGG-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide?
The IUPAC name of N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide (CID 70289449) is N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide.
What is the SMILES notation for N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide?
The canonical SMILES for N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide is CC(=O)NCCN1CCN(C(=O)C2=CNCC=N2)CC1.
What is the InChIKey of N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide?
The InChIKey is GDPLOAVCPVEMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5O2/c1-11(19)15-4-5-17-6-8-18(9-7-17)13(20)12-10-14-2-3-16-12/h3,10,14H,2,4-9H2,1H3,(H,15,19).
What are the key properties of N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide?
N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide has a molecular weight of 279.34 g/mol, XLogP of -1.22, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(1,2-dihydropyrazine-5-carbonyl)piperazin-1-yl]ethyl]acetamide is sourced from PubChem (CID 70289449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).