About (4R)-1,4-dimethyl-3a,4-dihydroindole
(4R)-1,4-dimethyl-3a,4-dihydroindole (PubChem CID 70289602) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is (4R)-1,4-dimethyl-3a,4-dihydroindole.
Molecular Properties
| Compound Name | (4R)-1,4-dimethyl-3a,4-dihydroindole |
| PubChem CID | 70289602 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (4R)-1,4-dimethyl-3a,4-dihydroindole |
| SMILES | C[C@@H]1C=CC=C2C1C=CN2C |
| InChI | InChI=1S/C10H13N/c1-8-4-3-5-10-9(8)6-7-11(10)2/h3-9H,1-2H3/t8-,9?/m1/s1 |
| InChIKey | LUPVNPNVPVQWJI-VEDVMXKPSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-1,4-dimethyl-3a,4-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1,4-dimethyl-3a,4-dihydroindole?
The IUPAC name of (4R)-1,4-dimethyl-3a,4-dihydroindole (CID 70289602) is (4R)-1,4-dimethyl-3a,4-dihydroindole.
What is the SMILES notation for (4R)-1,4-dimethyl-3a,4-dihydroindole?
The canonical SMILES for (4R)-1,4-dimethyl-3a,4-dihydroindole is C[C@@H]1C=CC=C2C1C=CN2C.
What is the InChIKey of (4R)-1,4-dimethyl-3a,4-dihydroindole?
The InChIKey is LUPVNPNVPVQWJI-VEDVMXKPSA-N. The full InChI is InChI=1S/C10H13N/c1-8-4-3-5-10-9(8)6-7-11(10)2/h3-9H,1-2H3/t8-,9?/m1/s1.
What are the key properties of (4R)-1,4-dimethyl-3a,4-dihydroindole?
(4R)-1,4-dimethyl-3a,4-dihydroindole has a molecular weight of 147.22 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1,4-dimethyl-3a,4-dihydroindole is sourced from PubChem (CID 70289602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).