About 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one
3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one (PubChem CID 70289948) has the molecular formula C24H23NO3
and a molecular weight of 373.45 g/mol. Its IUPAC name is 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one.
Molecular Properties
| Compound Name | 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one |
| PubChem CID | 70289948 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one |
| SMILES | Cc1cc(C2(c3cc(C)c(O)c(C)c3)NC(=O)c3ccccc32)cc(C)c1O |
| InChI | InChI=1S/C24H23NO3/c1-13-9-17(10-14(2)21(13)26)24(18-11-15(3)22(27)16(4)12-18)20-8-6-5-7-19(20)23(28)25-24/h5-12,26-27H,1-4H3,(H,25,28) |
| InChIKey | NMYHYTQHGXPWQU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one?
The IUPAC name of 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one (CID 70289948) is 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one.
What is the SMILES notation for 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one?
The canonical SMILES for 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one is Cc1cc(C2(c3cc(C)c(O)c(C)c3)NC(=O)c3ccccc32)cc(C)c1O.
What is the InChIKey of 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one?
The InChIKey is NMYHYTQHGXPWQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO3/c1-13-9-17(10-14(2)21(13)26)24(18-11-15(3)22(27)16(4)12-18)20-8-6-5-7-19(20)23(28)25-24/h5-12,26-27H,1-4H3,(H,25,28).
What are the key properties of 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one?
3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one has a molecular weight of 373.45 g/mol, XLogP of 4.37, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2H-isoindol-1-one is sourced from PubChem (CID 70289948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).