About amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine
amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine (PubChem CID 70290024) has the molecular formula C24H31N3O3
and a molecular weight of 409.53 g/mol. Its IUPAC name is amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine.
Molecular Properties
| Compound Name | amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine |
| PubChem CID | 70290024 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine |
| SMILES | NOC(=O)[C@]1(C(=O)CCCc2ccccc2)CCCN1.Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H20N2O3.C9H11N/c16-20-14(19)15(10-5-11-17-15)13(18)9-4-8-12-6-2-1-3-7-12;10-9-5-4-7-2-1-3-8(7)6-9/h1-3,6-7,17H,4-5,8-11,16H2;4-6H,1-3,10H2/t15-;/m1./s1 |
| InChIKey | QUDZCDKBAORGCR-XFULWGLBSA-N |
| XLogP | 2.88 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine?
The IUPAC name of amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine (CID 70290024) is amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine.
What is the SMILES notation for amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine?
The canonical SMILES for amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine is NOC(=O)[C@]1(C(=O)CCCc2ccccc2)CCCN1.Nc1ccc2c(c1)CCC2.
What is the InChIKey of amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine?
The InChIKey is QUDZCDKBAORGCR-XFULWGLBSA-N. The full InChI is InChI=1S/C15H20N2O3.C9H11N/c16-20-14(19)15(10-5-11-17-15)13(18)9-4-8-12-6-2-1-3-7-12;10-9-5-4-7-2-1-3-8(7)6-9/h1-3,6-7,17H,4-5,8-11,16H2;4-6H,1-3,10H2/t15-;/m1./s1.
What are the key properties of amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine?
amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine has a molecular weight of 409.53 g/mol, XLogP of 2.88, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for amino (2R)-2-(4-phenylbutanoyl)pyrrolidine-2-carboxylate;2,3-dihydro-1H-inden-5-amine is sourced from PubChem (CID 70290024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).