C27H30FNO3 — CID 70290247
3-tert-butyl-4-[ethyl-[(2-phenylmethoxyphenyl)methyl]amino]-2-fluorobenzoic acid (PubChem CID 70290247) has the molecular formula C27H30FNO3 and a molecular weight of 435.54 g/mol. Its IUPAC name is 3-tert-butyl-4-[ethyl-[(2-phenylmethoxyphenyl)methyl]amino]-2-fluorobenzoic acid.
| Compound Name | 3-tert-butyl-4-[ethyl-[(2-phenylmethoxyphenyl)methyl]amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 70290247 |
| Molecular Formula | C27H30FNO3 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 3-tert-butyl-4-[ethyl-[(2-phenylmethoxyphenyl)methyl]amino]-2-fluorobenzoic acid |
| SMILES | CCN(Cc1ccccc1OCc1ccccc1)c1ccc(C(=O)O)c(F)c1C(C)(C)C |
| InChI | InChI=1S/C27H30FNO3/c1-5-29(22-16-15-21(26(30)31)25(28)24(22)27(2,3)4)17-20-13-9-10-14-23(20)32-18-19-11-7-6-8-12-19/h6-16H,5,17-18H2,1-4H3,(H,30,31) |
| InChIKey | IDTJNNCDGXOVDX-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |