About [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate
[1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate (PubChem CID 70290354) has the molecular formula C32H25N3O2
and a molecular weight of 483.57 g/mol. Its IUPAC name is [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate.
Molecular Properties
| Compound Name | [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate |
| PubChem CID | 70290354 |
| Molecular Formula | C32H25N3O2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate |
| SMILES | N#Cc1ccc(C(OC(=O)Cc2cnc[nH]2)C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H25N3O2/c33-21-24-16-18-25(19-17-24)31(37-30(36)20-29-22-34-23-35-29)32(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-19,22-23,31H,20H2,(H,34,35) |
| InChIKey | VSXBIERVWFQSAP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate?
The IUPAC name of [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate (CID 70290354) is [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate.
What is the SMILES notation for [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate?
The canonical SMILES for [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate is N#Cc1ccc(C(OC(=O)Cc2cnc[nH]2)C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate?
The InChIKey is VSXBIERVWFQSAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H25N3O2/c33-21-24-16-18-25(19-17-24)31(37-30(36)20-29-22-34-23-35-29)32(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-19,22-23,31H,20H2,(H,34,35).
What are the key properties of [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate?
[1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate has a molecular weight of 483.57 g/mol, XLogP of 6.14, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-cyanophenyl)-2,2,2-triphenylethyl] 2-(1H-imidazol-5-yl)acetate is sourced from PubChem (CID 70290354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).