About 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile
3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile (PubChem CID 70290808) has the molecular formula C22H11F3N2O2S
and a molecular weight of 424.40 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile.
Molecular Properties
| Compound Name | 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile |
| PubChem CID | 70290808 |
| Molecular Formula | C22H11F3N2O2S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile |
| SMILES | N#Cc1ccc2c(-c3ccccc3F)c(S(=O)(=O)c3cc(F)cc(F)c3)cnc2c1 |
| InChI | InChI=1S/C22H11F3N2O2S/c23-14-8-15(24)10-16(9-14)30(28,29)21-12-27-20-7-13(11-26)5-6-18(20)22(21)17-3-1-2-4-19(17)25/h1-10,12H |
| InChIKey | HCAIIVCDIARFJB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 70.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile?
The IUPAC name of 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile (CID 70290808) is 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile.
What is the SMILES notation for 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile?
The canonical SMILES for 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile is N#Cc1ccc2c(-c3ccccc3F)c(S(=O)(=O)c3cc(F)cc(F)c3)cnc2c1.
What is the InChIKey of 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile?
The InChIKey is HCAIIVCDIARFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H11F3N2O2S/c23-14-8-15(24)10-16(9-14)30(28,29)21-12-27-20-7-13(11-26)5-6-18(20)22(21)17-3-1-2-4-19(17)25/h1-10,12H.
What are the key properties of 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile?
3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile has a molecular weight of 424.40 g/mol, XLogP of 5.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluorophenyl)sulfonyl-4-(2-fluorophenyl)quinoline-7-carbonitrile is sourced from PubChem (CID 70290808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).