About copper;10H-phenothiazin-1-yl acetate
copper;10H-phenothiazin-1-yl acetate (PubChem CID 70290846) has the molecular formula C14H11CuNO2S
and a molecular weight of 320.86 g/mol. Its IUPAC name is copper;10H-phenothiazin-1-yl acetate.
Molecular Properties
| Compound Name | copper;10H-phenothiazin-1-yl acetate |
| PubChem CID | 70290846 |
| Molecular Formula | C14H11CuNO2S |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | copper;10H-phenothiazin-1-yl acetate |
| SMILES | CC(=O)Oc1cccc2c1Nc1ccccc1S2.[Cu] |
| InChI | InChI=1S/C14H11NO2S.Cu/c1-9(16)17-11-6-4-8-13-14(11)15-10-5-2-3-7-12(10)18-13;/h2-8,15H,1H3; |
| InChIKey | KDFLASZKNZHHPU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze copper;10H-phenothiazin-1-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;10H-phenothiazin-1-yl acetate?
The IUPAC name of copper;10H-phenothiazin-1-yl acetate (CID 70290846) is copper;10H-phenothiazin-1-yl acetate.
What is the SMILES notation for copper;10H-phenothiazin-1-yl acetate?
The canonical SMILES for copper;10H-phenothiazin-1-yl acetate is CC(=O)Oc1cccc2c1Nc1ccccc1S2.[Cu].
What is the InChIKey of copper;10H-phenothiazin-1-yl acetate?
The InChIKey is KDFLASZKNZHHPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2S.Cu/c1-9(16)17-11-6-4-8-13-14(11)15-10-5-2-3-7-12(10)18-13;/h2-8,15H,1H3;.
What are the key properties of copper;10H-phenothiazin-1-yl acetate?
copper;10H-phenothiazin-1-yl acetate has a molecular weight of 320.86 g/mol, XLogP of 3.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;10H-phenothiazin-1-yl acetate is sourced from PubChem (CID 70290846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).