About 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one
6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 70291043) has the molecular formula C15H12ClNO
and a molecular weight of 257.72 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 70291043 |
| Molecular Formula | C15H12ClNO |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCCc2cc(-c3cccc(Cl)c3)ccc21 |
| InChI | InChI=1S/C15H12ClNO/c16-13-3-1-2-10(9-13)11-4-5-14-12(8-11)6-7-17-15(14)18/h1-5,8-9H,6-7H2,(H,17,18) |
| InChIKey | VYSHKUXCRTVUNN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one (CID 70291043) is 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one is O=C1NCCc2cc(-c3cccc(Cl)c3)ccc21.
What is the InChIKey of 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is VYSHKUXCRTVUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClNO/c16-13-3-1-2-10(9-13)11-4-5-14-12(8-11)6-7-17-15(14)18/h1-5,8-9H,6-7H2,(H,17,18).
What are the key properties of 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one?
6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 257.72 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-chlorophenyl)-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 70291043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).