C20H23NO6 — CID 70291203
(1R,2R)-1-(2-methoxyphenoxy)-N,N-dimethyl-2,3-dihydro-1H-inden-2-amine;oxalic acid (PubChem CID 70291203) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is (1R,2R)-1-(2-methoxyphenoxy)-N,N-dimethyl-2,3-dihydro-1H-inden-2-amine;oxalic acid.
| Compound Name | (1R,2R)-1-(2-methoxyphenoxy)-N,N-dimethyl-2,3-dihydro-1H-inden-2-amine;oxalic acid |
|---|---|
| PubChem CID | 70291203 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (1R,2R)-1-(2-methoxyphenoxy)-N,N-dimethyl-2,3-dihydro-1H-inden-2-amine;oxalic acid |
| SMILES | COc1ccccc1O[C@@H]1c2ccccc2C[C@H]1N(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H21NO2.C2H2O4/c1-19(2)15-12-13-8-4-5-9-14(13)18(15)21-17-11-7-6-10-16(17)20-3;3-1(4)2(5)6/h4-11,15,18H,12H2,1-3H3;(H,3,4)(H,5,6)/t15-,18-;/m1./s1 |
| InChIKey | ZERDNFANYBFTFT-KQKCUOLZSA-N |
| XLogP | 2.46 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|