C20H31NO — CID 70291226
(1R,2R,3R,4R)-2-butyl-1,7,7-trimethyl-3-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-ol (PubChem CID 70291226) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (1R,2R,3R,4R)-2-butyl-1,7,7-trimethyl-3-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,3R,4R)-2-butyl-1,7,7-trimethyl-3-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 70291226 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (1R,2R,3R,4R)-2-butyl-1,7,7-trimethyl-3-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-ol |
| SMILES | CCCC[C@@]1(O)[C@H](Cc2ccccn2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C20H31NO/c1-5-6-11-20(22)17(14-15-9-7-8-13-21-15)16-10-12-19(20,4)18(16,2)3/h7-9,13,16-17,22H,5-6,10-12,14H2,1-4H3/t16-,17-,19-,20-/m1/s1 |
| InChIKey | VRIMCTUUYBJYBU-HNBVOPMISA-N |
| XLogP | 4.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |