C27H24N6O6 — CID 70291973
2-[4,6-bis(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)-1,3,5-triazin-2-yl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 70291973) has the molecular formula C27H24N6O6 and a molecular weight of 528.53 g/mol. Its IUPAC name is 2-[4,6-bis(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)-1,3,5-triazin-2-yl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[4,6-bis(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)-1,3,5-triazin-2-yl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 70291973 |
| Molecular Formula | C27H24N6O6 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 2-[4,6-bis(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)-1,3,5-triazin-2-yl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2C=CCCC2C(=O)N1c1nc(N2C(=O)C3C=CCCC3C2=O)nc(N2C(=O)C3C=CCCC3C2=O)n1 |
| InChI | InChI=1S/C27H24N6O6/c34-19-13-7-1-2-8-14(13)20(35)31(19)25-28-26(32-21(36)15-9-3-4-10-16(15)22(32)37)30-27(29-25)33-23(38)17-11-5-6-12-18(17)24(33)39/h1,3,5,7,9,11,13-18H,2,4,6,8,10,12H2 |
| InChIKey | HOVACCACYCAUGP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 150.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|