About 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine
1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine (PubChem CID 70292512) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine.
Molecular Properties
| Compound Name | 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine |
| PubChem CID | 70292512 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine |
| SMILES | CCCCCOC1(N)CCCc2ccccc21 |
| InChI | InChI=1S/C15H23NO/c1-2-3-6-12-17-15(16)11-7-9-13-8-4-5-10-14(13)15/h4-5,8,10H,2-3,6-7,9,11-12,16H2,1H3 |
| InChIKey | LJAXORDPALHDAH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine?
The IUPAC name of 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine (CID 70292512) is 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine.
What is the SMILES notation for 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine?
The canonical SMILES for 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine is CCCCCOC1(N)CCCc2ccccc21.
What is the InChIKey of 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine?
The InChIKey is LJAXORDPALHDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-2-3-6-12-17-15(16)11-7-9-13-8-4-5-10-14(13)15/h4-5,8,10H,2-3,6-7,9,11-12,16H2,1H3.
What are the key properties of 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine?
1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine has a molecular weight of 233.35 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentoxy-3,4-dihydro-2H-naphthalen-1-amine is sourced from PubChem (CID 70292512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).