C40H42N6O7 — CID 70293118
benzhydryl 3-[4-[2-[[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]benzoyl]amino]ethyl]-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate (PubChem CID 70293118) has the molecular formula C40H42N6O7 and a molecular weight of 718.81 g/mol. Its IUPAC name is benzhydryl 3-[4-[2-[[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]benzoyl]amino]ethyl]-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate.
| Compound Name | benzhydryl 3-[4-[2-[[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]benzoyl]amino]ethyl]-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 70293118 |
| Molecular Formula | C40H42N6O7 |
| Molecular Weight | 718.81 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | benzhydryl 3-[4-[2-[[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]benzoyl]amino]ethyl]-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate |
| SMILES | CC(C)(C)OC(=O)N=C(N)c1ccc(C(=O)NCCN2CCN(C(CC(=O)OC(c3ccccc3)c3ccccc3)c3cccnc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C40H42N6O7/c1-40(2,3)53-39(51)44-35(41)29-16-18-30(19-17-29)36(48)43-21-22-45-23-24-46(38(50)37(45)49)32(31-15-10-20-42-26-31)25-33(47)52-34(27-11-6-4-7-12-27)28-13-8-5-9-14-28/h4-20,26,32,34H,21-25H2,1-3H3,(H,43,48)(H2,41,44,51) |
| InChIKey | NNCXRZWUXHUMNR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 173.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.81 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|