About carbonic acid;oxane
carbonic acid;oxane (PubChem CID 70293219) has the molecular formula C11H22O5
and a molecular weight of 234.29 g/mol. Its IUPAC name is carbonic acid;oxane.
Molecular Properties
| Compound Name | carbonic acid;oxane |
| PubChem CID | 70293219 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | carbonic acid;oxane |
| SMILES | C1CCOCC1.C1CCOCC1.O=C(O)O |
| InChI | InChI=1S/2C5H10O.CH2O3/c2*1-2-4-6-5-3-1;2-1(3)4/h2*1-5H2;(H2,2,3,4) |
| InChIKey | GPXRAPSOHMBRQQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbonic acid;oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;oxane?
The IUPAC name of carbonic acid;oxane (CID 70293219) is carbonic acid;oxane.
What is the SMILES notation for carbonic acid;oxane?
The canonical SMILES for carbonic acid;oxane is C1CCOCC1.C1CCOCC1.O=C(O)O.
What is the InChIKey of carbonic acid;oxane?
The InChIKey is GPXRAPSOHMBRQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H10O.CH2O3/c2*1-2-4-6-5-3-1;2-1(3)4/h2*1-5H2;(H2,2,3,4).
What are the key properties of carbonic acid;oxane?
carbonic acid;oxane has a molecular weight of 234.29 g/mol, XLogP of 2.60, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;oxane is sourced from PubChem (CID 70293219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).