About 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole
4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole (PubChem CID 70293533) has the molecular formula C21H23F2NO2
and a molecular weight of 359.42 g/mol. Its IUPAC name is 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole |
| PubChem CID | 70293533 |
| Molecular Formula | C21H23F2NO2 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole |
| SMILES | CC(C)(C)C1(OCCc2ccccc2)N=C(c2ccccc2)OC1(F)F |
| InChI | InChI=1S/C21H23F2NO2/c1-19(2,3)20(25-15-14-16-10-6-4-7-11-16)21(22,23)26-18(24-20)17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3 |
| InChIKey | UVHWMRZHWARDDR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole?
The IUPAC name of 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole (CID 70293533) is 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole.
What is the SMILES notation for 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole?
The canonical SMILES for 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole is CC(C)(C)C1(OCCc2ccccc2)N=C(c2ccccc2)OC1(F)F.
What is the InChIKey of 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole?
The InChIKey is UVHWMRZHWARDDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F2NO2/c1-19(2,3)20(25-15-14-16-10-6-4-7-11-16)21(22,23)26-18(24-20)17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3.
What are the key properties of 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole?
4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole has a molecular weight of 359.42 g/mol, XLogP of 5.06, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-5,5-difluoro-2-phenyl-4-(2-phenylethoxy)-1,3-oxazole is sourced from PubChem (CID 70293533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).