C29H21F2N3O6 — CID 70294552
(4-nitrophenyl) 4-(3,4-difluorophenyl)-5-[(4-methoxyphenyl)methyl]-2-oxo-1,4-dihydroquinazoline-3-carboxylate (PubChem CID 70294552) has the molecular formula C29H21F2N3O6 and a molecular weight of 545.50 g/mol. Its IUPAC name is (4-nitrophenyl) 4-(3,4-difluorophenyl)-5-[(4-methoxyphenyl)methyl]-2-oxo-1,4-dihydroquinazoline-3-carboxylate.
| Compound Name | (4-nitrophenyl) 4-(3,4-difluorophenyl)-5-[(4-methoxyphenyl)methyl]-2-oxo-1,4-dihydroquinazoline-3-carboxylate |
|---|---|
| PubChem CID | 70294552 |
| Molecular Formula | C29H21F2N3O6 |
| Molecular Weight | 545.50 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | (4-nitrophenyl) 4-(3,4-difluorophenyl)-5-[(4-methoxyphenyl)methyl]-2-oxo-1,4-dihydroquinazoline-3-carboxylate |
| SMILES | COc1ccc(Cc2cccc3c2C(c2ccc(F)c(F)c2)N(C(=O)Oc2ccc([N+](=O)[O-])cc2)C(=O)N3)cc1 |
| InChI | InChI=1S/C29H21F2N3O6/c1-39-21-10-5-17(6-11-21)15-18-3-2-4-25-26(18)27(19-7-14-23(30)24(31)16-19)33(28(35)32-25)29(36)40-22-12-8-20(9-13-22)34(37)38/h2-14,16,27H,15H2,1H3,(H,32,35) |
| InChIKey | CQLPACZGXAXZDA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|